 |
|
Your location>> Home>>Products |
 |
N-Chlorosuccinimide |
| product name: |
N-Chlorosuccinimide |
| CAS NO: |
128-09-6 |
| Molecular weight: |
133.5331 |
| EC NO: |
204-878-8 |
| Formula: |
C4H4ClNO2 |
| InChI： |
InChI=1/C4H4ClNO2/c5-6-3(7)1-2-4(6)8/h1-2H2 |
| Specification: |
More than 98% |
| package: |
25 kg drum |
| Product description: |
Appearance light yellow to white crystals
Content of 98%
Available chlorine ≥26
Melting point 144-153 (℃)
Loss on drying ≤1
Maximum sulfur content of 0.2%
Up to 0.02% free acid |
| Use: |
Mainly used in general organic synthesis such as pharmaceuticals, synthetic fragrances, agricultural chemicals, but also for the synthesis of norethindrone bio-pharmaceutical and other organic synthesis. It can also be used as a surface treatment agent to improve the performance of organic synthetic fibers, and make it easy to fade. |
| Alias: |
N-chlorosuccinimide; diethyl chloro imides; NCS; N-chloroprene diamide; chlorosuccinimide; chlorosuccinimide; succinyl chloride imine |
| Structure: |
 |
| Appearance: |
White crystal |
| Content: |
≥98.5％ |
| Melting point: |
144-153℃ |
| Available chlorine: |
＞26％ |
| Residue on ignition: |
＜0.2％ |
| Loss on drying: |
≤0.5％ |
|
|
|
