 |
|
Your location>> Home>>Products |
 |
N-Hydroxy succinimide |
| product name: |
N-Hydroxy succinimide |
| CAS NO: |
6066-82-6 |
| Molecular weight: |
115.0874 |
| EC NO: |
228-001-3 |
| Formula: |
C4H5NO3 |
| InChI： |
InChI=1/C4H5NO3/c6-3-1-2-4(7)5(3)8/h8H,1-2H2 |
| Specification: |
Appearance:White Results；Content:≥99% |
| package: |
Cardboard drum, net weight 25 kg |
| Use: |
Protection agents for the synthesis of amino acids pharmaceutical intermediates. |
| Alias: |
Succinimide, N-hydroxy-;2,5-Pyrrolidinedione, 1-hydroxy-;Hydroxysuccinimide;Succinimide, N-hydroxy- (8CI);1-Hydroxy-2,5-pyrrolidinedione;1-Hydroxysuccinimide;1-Hydroxy-pyrrolidine-2,5-dione;N-Hydroxy Succinimide; |
| Structure: |
 |
| Appearance: |
White or slightly yellow crystals |
| Content: |
＞99％ |
| Related substances (TLC): |
Shall comply with the provisions of |
| Melting point: |
95~100℃ |
| Loss on drying: |
≤0.5％ |
|
|
|
