 |
|
Your location>> Home>>Products |
 |
N-Iodosuccinimide |
| product name: |
N-Iodosuccinimide |
| CAS NO: |
516-12-1 |
| Molecular weight: |
224.98 |
| EC NO: |
208-221-6 |
| Formula: |
C4H4INO2 |
| InChI: |
InChI=1/C4H4INO2/c5-6-3(7)1-2-4(6)8/h1-2H2 |
| Specification: |
More than 99% |
| package: |
25 kg drum |
| Product description: |
Appearance white crystal
Content of 98%
Melting point 192-198 (℃)
Loss on drying ≤1%
Maximum sulfur content of 0.2%
Up to 0.02% free acid |
| Use: |
Primarily as a biopharmaceutical of pharmaceutical intermediates. |
| Alias: |
1-IODO-2,5-PYRROLIDINEDIONE ; NIS ; 1-iodo-5-pyrrolidinedione ; n-iodo-succinimid ; Succinimide,N-iodo- ; succiniodimide ; 1-iodopyrrolidine-2,5-dione ; Iodosuccinimide ; 2,5-Pyrrolidinedione, 1-iodo- ; |
| Structure: |
 |
| Appearance: |
White or slightly yellow |
| Content: |
>99% |
| Iodine content: |
55-58% |
| Melting point: |
192-198℃ |
| Free acid: |
≤0.20% |
| Loss on drying: |
≤0.50% |
|
|
|
